C13H10N2O3S — CID 15896028
7-hydroxy-4,8-dimethyl-6-(thiadiazol-4-yl)chromen-2-one (PubChem CID 15896028) has the molecular formula C13H10N2O3S and a molecular weight of 274.30 g/mol. Its IUPAC name is 7-hydroxy-4,8-dimethyl-6-(thiadiazol-4-yl)chromen-2-one.
| Compound Name | 7-hydroxy-4,8-dimethyl-6-(thiadiazol-4-yl)chromen-2-one |
|---|---|
| PubChem CID | 15896028 |
| Molecular Formula | C13H10N2O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 7-hydroxy-4,8-dimethyl-6-(thiadiazol-4-yl)chromen-2-one |
| SMILES | Cc1cc(=O)oc2c(C)c(O)c(-c3csnn3)cc12 |
| InChI | InChI=1S/C13H10N2O3S/c1-6-3-11(16)18-13-7(2)12(17)9(4-8(6)13)10-5-19-15-14-10/h3-5,17H,1-2H3 |
| InChIKey | PGSKABYSKOPNJG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|