C16H15N3O3 — CID 135629337
6-(2-aminopyrimidin-4-yl)-7-hydroxy-3,4,8-trimethylchromen-2-one (PubChem CID 135629337) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 6-(2-aminopyrimidin-4-yl)-7-hydroxy-3,4,8-trimethylchromen-2-one.
| Compound Name | 6-(2-aminopyrimidin-4-yl)-7-hydroxy-3,4,8-trimethylchromen-2-one |
|---|---|
| PubChem CID | 135629337 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 6-(2-aminopyrimidin-4-yl)-7-hydroxy-3,4,8-trimethylchromen-2-one |
| SMILES | Cc1c(C)c2cc(-c3ccnc(N)n3)c(O)c(C)c2oc1=O |
| InChI | InChI=1S/C16H15N3O3/c1-7-8(2)15(21)22-14-9(3)13(20)11(6-10(7)14)12-4-5-18-16(17)19-12/h4-6,20H,1-3H3,(H2,17,18,19) |
| InChIKey | LJIXLYCADYQHKN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|