C26H20ClN3O5 — CID 146048774
1-[(4-chlorophenyl)methyl]-7-(7-hydroxy-3,4,8-trimethyl-2-oxochromen-6-yl)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 146048774) has the molecular formula C26H20ClN3O5 and a molecular weight of 489.92 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-7-(7-hydroxy-3,4,8-trimethyl-2-oxochromen-6-yl)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-7-(7-hydroxy-3,4,8-trimethyl-2-oxochromen-6-yl)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 146048774 |
| Molecular Formula | C26H20ClN3O5 |
| Molecular Weight | 489.92 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-7-(7-hydroxy-3,4,8-trimethyl-2-oxochromen-6-yl)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1c(C)c2cc(-c3ccc4c(=O)[nH]c(=O)n(Cc5ccc(Cl)cc5)c4n3)c(O)c(C)c2oc1=O |
| InChI | InChI=1S/C26H20ClN3O5/c1-12-13(2)25(33)35-22-14(3)21(31)19(10-18(12)22)20-9-8-17-23(28-20)30(26(34)29-24(17)32)11-15-4-6-16(27)7-5-15/h4-10,31H,11H2,1-3H3,(H,29,32,34) |
| InChIKey | IKOKMQVGNLOWJE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 118.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.92 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|