C19H16N2O4S — CID 137250190
7-hydroxy-4,8-dimethyl-6-[3-methyl-4-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazol-5-yl]chromen-2-one (PubChem CID 137250190) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is 7-hydroxy-4,8-dimethyl-6-[3-methyl-4-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazol-5-yl]chromen-2-one.
| Compound Name | 7-hydroxy-4,8-dimethyl-6-[3-methyl-4-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazol-5-yl]chromen-2-one |
|---|---|
| PubChem CID | 137250190 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 7-hydroxy-4,8-dimethyl-6-[3-methyl-4-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazol-5-yl]chromen-2-one |
| SMILES | Cc1csc(-c2c(C)noc2-c2cc3c(C)cc(=O)oc3c(C)c2O)n1 |
| InChI | InChI=1S/C19H16N2O4S/c1-8-5-14(22)24-17-10(3)16(23)13(6-12(8)17)18-15(11(4)21-25-18)19-20-9(2)7-26-19/h5-7,23H,1-4H3 |
| InChIKey | JORHCYCSBSUAPX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|