C13H7Cl2NO2S — CID 780522
6,8-dichloro-3-(4-methyl-1,3-thiazol-2-yl)chromen-2-one (PubChem CID 780522) has the molecular formula C13H7Cl2NO2S and a molecular weight of 312.18 g/mol. Its IUPAC name is 6,8-dichloro-3-(4-methyl-1,3-thiazol-2-yl)chromen-2-one.
| Compound Name | 6,8-dichloro-3-(4-methyl-1,3-thiazol-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 780522 |
| Molecular Formula | C13H7Cl2NO2S |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 310.96 |
| IUPAC Name | 6,8-dichloro-3-(4-methyl-1,3-thiazol-2-yl)chromen-2-one |
| SMILES | Cc1csc(-c2cc3cc(Cl)cc(Cl)c3oc2=O)n1 |
| InChI | InChI=1S/C13H7Cl2NO2S/c1-6-5-19-12(16-6)9-3-7-2-8(14)4-10(15)11(7)18-13(9)17/h2-5H,1H3 |
| InChIKey | UERXNGHZPZKGOK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|