C28H25N3O4S — CID 2543945
N-[4-(1-benzyl-2,5-dimethylpyrrol-3-yl)-1,3-thiazol-2-yl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide (PubChem CID 2543945) has the molecular formula C28H25N3O4S and a molecular weight of 499.59 g/mol. Its IUPAC name is N-[4-(1-benzyl-2,5-dimethylpyrrol-3-yl)-1,3-thiazol-2-yl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[4-(1-benzyl-2,5-dimethylpyrrol-3-yl)-1,3-thiazol-2-yl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 2543945 |
| Molecular Formula | C28H25N3O4S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N-[4-(1-benzyl-2,5-dimethylpyrrol-3-yl)-1,3-thiazol-2-yl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)Nc3nc(-c4cc(C)n(Cc5ccccc5)c4C)cs3)ccc12 |
| InChI | InChI=1S/C28H25N3O4S/c1-17-11-27(33)35-25-13-21(9-10-22(17)25)34-15-26(32)30-28-29-24(16-36-28)23-12-18(2)31(19(23)3)14-20-7-5-4-6-8-20/h4-13,16H,14-15H2,1-3H3,(H,29,30,32) |
| InChIKey | AYJLJBGLJBFFOG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|