C29H25N3O2S — CID 2451829
N-[4-(1-benzyl-2,5-dimethylpyrrol-3-yl)-1,3-thiazol-2-yl]-2-phenoxybenzamide (PubChem CID 2451829) has the molecular formula C29H25N3O2S and a molecular weight of 479.61 g/mol. Its IUPAC name is N-[4-(1-benzyl-2,5-dimethylpyrrol-3-yl)-1,3-thiazol-2-yl]-2-phenoxybenzamide.
| Compound Name | N-[4-(1-benzyl-2,5-dimethylpyrrol-3-yl)-1,3-thiazol-2-yl]-2-phenoxybenzamide |
|---|---|
| PubChem CID | 2451829 |
| Molecular Formula | C29H25N3O2S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | N-[4-(1-benzyl-2,5-dimethylpyrrol-3-yl)-1,3-thiazol-2-yl]-2-phenoxybenzamide |
| SMILES | Cc1cc(-c2csc(NC(=O)c3ccccc3Oc3ccccc3)n2)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C29H25N3O2S/c1-20-17-25(21(2)32(20)18-22-11-5-3-6-12-22)26-19-35-29(30-26)31-28(33)24-15-9-10-16-27(24)34-23-13-7-4-8-14-23/h3-17,19H,18H2,1-2H3,(H,30,31,33) |
| InChIKey | DDXNUFFPHHPTRN-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |