C24H25NO5 — CID 59243640
1-heptyl-3-[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyaziridin-2-one (PubChem CID 59243640) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-heptyl-3-[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyaziridin-2-one.
| Compound Name | 1-heptyl-3-[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyaziridin-2-one |
|---|---|
| PubChem CID | 59243640 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 1-heptyl-3-[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyaziridin-2-one |
| SMILES | CCCCCCCN1C(=O)C1Oc1ccc2c(=O)c(-c3ccc(O)cc3)coc2c1 |
| InChI | InChI=1S/C24H25NO5/c1-2-3-4-5-6-13-25-23(28)24(25)30-18-11-12-19-21(14-18)29-15-20(22(19)27)16-7-9-17(26)10-8-16/h7-12,14-15,24,26H,2-6,13H2,1H3 |
| InChIKey | ZJCMYJGGEVFMDI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 79.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|