C25H24O10 — CID 125121075
[(2R)-1-[3-(4-acetyloxyphenyl)-6-methoxy-4-oxochromen-7-yl]oxy-1-oxopropan-2-yl] (2R)-2-methoxypropanoate (PubChem CID 125121075) has the molecular formula C25H24O10 and a molecular weight of 484.46 g/mol. Its IUPAC name is [(2R)-1-[3-(4-acetyloxyphenyl)-6-methoxy-4-oxochromen-7-yl]oxy-1-oxopropan-2-yl] (2R)-2-methoxypropanoate.
| Compound Name | [(2R)-1-[3-(4-acetyloxyphenyl)-6-methoxy-4-oxochromen-7-yl]oxy-1-oxopropan-2-yl] (2R)-2-methoxypropanoate |
|---|---|
| PubChem CID | 125121075 |
| Molecular Formula | C25H24O10 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | [(2R)-1-[3-(4-acetyloxyphenyl)-6-methoxy-4-oxochromen-7-yl]oxy-1-oxopropan-2-yl] (2R)-2-methoxypropanoate |
| SMILES | COc1cc2c(=O)c(-c3ccc(OC(C)=O)cc3)coc2cc1OC(=O)[C@@H](C)OC(=O)[C@@H](C)OC |
| InChI | InChI=1S/C25H24O10/c1-13(30-4)24(28)33-14(2)25(29)35-22-11-20-18(10-21(22)31-5)23(27)19(12-32-20)16-6-8-17(9-7-16)34-15(3)26/h6-14H,1-5H3/t13-,14-/m1/s1 |
| InChIKey | KFHLYAUADACOEL-ZIAGYGMSSA-N |
| XLogP | 3.27 |
| TPSA | 127.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|