C34H26O7 — CID 11635295
[4-[7-benzoyloxy-5-hydroxy-6-(3-methylbut-2-enyl)-4-oxochromen-3-yl]phenyl] benzoate (PubChem CID 11635295) has the molecular formula C34H26O7 and a molecular weight of 546.58 g/mol. Its IUPAC name is [4-[7-benzoyloxy-5-hydroxy-6-(3-methylbut-2-enyl)-4-oxochromen-3-yl]phenyl] benzoate.
| Compound Name | [4-[7-benzoyloxy-5-hydroxy-6-(3-methylbut-2-enyl)-4-oxochromen-3-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 11635295 |
| Molecular Formula | C34H26O7 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | [4-[7-benzoyloxy-5-hydroxy-6-(3-methylbut-2-enyl)-4-oxochromen-3-yl]phenyl] benzoate |
| SMILES | CC(C)=CCc1c(OC(=O)c2ccccc2)cc2occ(-c3ccc(OC(=O)c4ccccc4)cc3)c(=O)c2c1O |
| InChI | InChI=1S/C34H26O7/c1-21(2)13-18-26-28(41-34(38)24-11-7-4-8-12-24)19-29-30(31(26)35)32(36)27(20-39-29)22-14-16-25(17-15-22)40-33(37)23-9-5-3-6-10-23/h3-17,19-20,35H,18H2,1-2H3 |
| InChIKey | BFHLYXKJBPIKKT-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|