C29H34O7 — CID 163086226
2-(3,7-dimethylocta-2,6-dienyl)-1,3,6-trihydroxy-8-(4-hydroxy-3-methylbut-2-enyl)-7-methoxyxanthen-9-one (PubChem CID 163086226) has the molecular formula C29H34O7 and a molecular weight of 494.58 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,6-dienyl)-1,3,6-trihydroxy-8-(4-hydroxy-3-methylbut-2-enyl)-7-methoxyxanthen-9-one.
| Compound Name | 2-(3,7-dimethylocta-2,6-dienyl)-1,3,6-trihydroxy-8-(4-hydroxy-3-methylbut-2-enyl)-7-methoxyxanthen-9-one |
|---|---|
| PubChem CID | 163086226 |
| Molecular Formula | C29H34O7 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 2-(3,7-dimethylocta-2,6-dienyl)-1,3,6-trihydroxy-8-(4-hydroxy-3-methylbut-2-enyl)-7-methoxyxanthen-9-one |
| SMILES | COc1c(O)cc2oc3cc(O)c(CC=C(C)CCC=C(C)C)c(O)c3c(=O)c2c1CC=C(C)CO |
| InChI | InChI=1S/C29H34O7/c1-16(2)7-6-8-17(3)9-11-19-21(31)13-24-26(27(19)33)28(34)25-20(12-10-18(4)15-30)29(35-5)22(32)14-23(25)36-24/h7,9-10,13-14,30-33H,6,8,11-12,15H2,1-5H3 |
| InChIKey | NYNDEBFRZFBLCF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|