C30H36O7 — CID 25115657
7-(cyclohexylmethoxy)-5-hydroxy-3-(3-methylbut-2-enyl)-2-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 25115657) has the molecular formula C30H36O7 and a molecular weight of 508.61 g/mol. Its IUPAC name is 7-(cyclohexylmethoxy)-5-hydroxy-3-(3-methylbut-2-enyl)-2-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 7-(cyclohexylmethoxy)-5-hydroxy-3-(3-methylbut-2-enyl)-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 25115657 |
| Molecular Formula | C30H36O7 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 7-(cyclohexylmethoxy)-5-hydroxy-3-(3-methylbut-2-enyl)-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | COc1cc(-c2oc3cc(OCC4CCCCC4)cc(O)c3c(=O)c2CC=C(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C30H36O7/c1-18(2)11-12-22-28(32)27-23(31)15-21(36-17-19-9-7-6-8-10-19)16-24(27)37-29(22)20-13-25(33-3)30(35-5)26(14-20)34-4/h11,13-16,19,31H,6-10,12,17H2,1-5H3 |
| InChIKey | FCQUNQAYIBUNOS-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|