C25H30O4 — CID 163184478
4-hydroxy-5-methyl-3-[(2E,6E)-3,7,11-trimethyl-8-oxododeca-2,6,10-trienyl]chromen-2-one (PubChem CID 163184478) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is 4-hydroxy-5-methyl-3-[(2E,6E)-3,7,11-trimethyl-8-oxododeca-2,6,10-trienyl]chromen-2-one.
| Compound Name | 4-hydroxy-5-methyl-3-[(2E,6E)-3,7,11-trimethyl-8-oxododeca-2,6,10-trienyl]chromen-2-one |
|---|---|
| PubChem CID | 163184478 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 4-hydroxy-5-methyl-3-[(2E,6E)-3,7,11-trimethyl-8-oxododeca-2,6,10-trienyl]chromen-2-one |
| SMILES | CC(C)=CCC(=O)/C(C)=C/CC/C(C)=C/Cc1c(O)c2c(C)cccc2oc1=O |
| InChI | InChI=1S/C25H30O4/c1-16(2)12-15-21(26)18(4)9-6-8-17(3)13-14-20-24(27)23-19(5)10-7-11-22(23)29-25(20)28/h7,9-13,27H,6,8,14-15H2,1-5H3/b17-13+,18-9+ |
| InChIKey | CCFMVYXESPPZIC-CJIPTIHVSA-N |
| XLogP | 5.95 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|