C18H20O5 — CID 163045247
1-[4-hydroxy-3-(3-methylbut-2-enyl)-2-oxochromen-5-yl]ethyl acetate (PubChem CID 163045247) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is 1-[4-hydroxy-3-(3-methylbut-2-enyl)-2-oxochromen-5-yl]ethyl acetate.
| Compound Name | 1-[4-hydroxy-3-(3-methylbut-2-enyl)-2-oxochromen-5-yl]ethyl acetate |
|---|---|
| PubChem CID | 163045247 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1-[4-hydroxy-3-(3-methylbut-2-enyl)-2-oxochromen-5-yl]ethyl acetate |
| SMILES | CC(=O)OC(C)c1cccc2oc(=O)c(CC=C(C)C)c(O)c12 |
| InChI | InChI=1S/C18H20O5/c1-10(2)8-9-14-17(20)16-13(11(3)22-12(4)19)6-5-7-15(16)23-18(14)21/h5-8,11,20H,9H2,1-4H3 |
| InChIKey | YIOLLJGLSQKFKZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|