About acetic acid;1-methoxyphenazine
acetic acid;1-methoxyphenazine (PubChem CID 174937212) has the molecular formula C15H14N2O3
and a molecular weight of 270.29 g/mol. Its IUPAC name is acetic acid;1-methoxyphenazine.
Molecular Properties
| Compound Name | acetic acid;1-methoxyphenazine |
| PubChem CID | 174937212 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | acetic acid;1-methoxyphenazine |
| SMILES | CC(=O)O.COc1cccc2nc3ccccc3nc12 |
| InChI | InChI=1S/C13H10N2O.C2H4O2/c1-16-12-8-4-7-11-13(12)15-10-6-3-2-5-9(10)14-11;1-2(3)4/h2-8H,1H3;1H3,(H,3,4) |
| InChIKey | AOIJHRAWQWQUFU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;1-methoxyphenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1-methoxyphenazine?
The IUPAC name of acetic acid;1-methoxyphenazine (CID 174937212) is acetic acid;1-methoxyphenazine.
What is the SMILES notation for acetic acid;1-methoxyphenazine?
The canonical SMILES for acetic acid;1-methoxyphenazine is CC(=O)O.COc1cccc2nc3ccccc3nc12.
What is the InChIKey of acetic acid;1-methoxyphenazine?
The InChIKey is AOIJHRAWQWQUFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O.C2H4O2/c1-16-12-8-4-7-11-13(12)15-10-6-3-2-5-9(10)14-11;1-2(3)4/h2-8H,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;1-methoxyphenazine?
acetic acid;1-methoxyphenazine has a molecular weight of 270.29 g/mol, XLogP of 2.88, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-methoxyphenazine is sourced from PubChem (CID 174937212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).