C18H16N2O6 — CID 135604574
6,8,11-trihydroxy-4-methoxy-9,10-dihydro-7H-benzo[b]phenazine-8-carboxylic acid (PubChem CID 135604574) has the molecular formula C18H16N2O6 and a molecular weight of 356.33 g/mol. Its IUPAC name is 6,8,11-trihydroxy-4-methoxy-9,10-dihydro-7H-benzo[b]phenazine-8-carboxylic acid.
| Compound Name | 6,8,11-trihydroxy-4-methoxy-9,10-dihydro-7H-benzo[b]phenazine-8-carboxylic acid |
|---|---|
| PubChem CID | 135604574 |
| Molecular Formula | C18H16N2O6 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 6,8,11-trihydroxy-4-methoxy-9,10-dihydro-7H-benzo[b]phenazine-8-carboxylic acid |
| SMILES | COc1cccc2nc3c(O)c4c(c(O)c3nc12)CC(O)(C(=O)O)CC4 |
| InChI | InChI=1S/C18H16N2O6/c1-26-11-4-2-3-10-12(11)20-14-13(19-10)15(21)8-5-6-18(25,17(23)24)7-9(8)16(14)22/h2-4,21-22,25H,5-7H2,1H3,(H,23,24) |
| InChIKey | IULZXZBZPVRCAE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 133.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|