C12H15NO4 — CID 115041955
3-hydroxy-1-(2-methoxyphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 115041955) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 3-hydroxy-1-(2-methoxyphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-hydroxy-1-(2-methoxyphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 115041955 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 3-hydroxy-1-(2-methoxyphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | COc1ccccc1N1CCC(O)(C(=O)O)C1 |
| InChI | InChI=1S/C12H15NO4/c1-17-10-5-3-2-4-9(10)13-7-6-12(16,8-13)11(14)15/h2-5,16H,6-8H2,1H3,(H,14,15) |
| InChIKey | YFKNMAJDXUKYNW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |