C19H30N2O — CID 142573439
8-butyl-2-(2-methoxyphenyl)-2,8-diazaspiro[4.5]decane (PubChem CID 142573439) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is 8-butyl-2-(2-methoxyphenyl)-2,8-diazaspiro[4.5]decane.
| Compound Name | 8-butyl-2-(2-methoxyphenyl)-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 142573439 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 8-butyl-2-(2-methoxyphenyl)-2,8-diazaspiro[4.5]decane |
| SMILES | CCCCN1CCC2(CC1)CCN(c1ccccc1OC)C2 |
| InChI | InChI=1S/C19H30N2O/c1-3-4-12-20-13-9-19(10-14-20)11-15-21(16-19)17-7-5-6-8-18(17)22-2/h5-8H,3-4,9-16H2,1-2H3 |
| InChIKey | FXUMDUOHWITHIX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |