C29H38N4OS — CID 155539413
3-(2-methoxyphenyl)-9-[3-(1-methyl-5-phenylimidazol-2-yl)sulfanylpropyl]-3,9-diazaspiro[5.5]undecane (PubChem CID 155539413) has the molecular formula C29H38N4OS and a molecular weight of 490.72 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-9-[3-(1-methyl-5-phenylimidazol-2-yl)sulfanylpropyl]-3,9-diazaspiro[5.5]undecane.
| Compound Name | 3-(2-methoxyphenyl)-9-[3-(1-methyl-5-phenylimidazol-2-yl)sulfanylpropyl]-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 155539413 |
| Molecular Formula | C29H38N4OS |
| Molecular Weight | 490.72 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 3-(2-methoxyphenyl)-9-[3-(1-methyl-5-phenylimidazol-2-yl)sulfanylpropyl]-3,9-diazaspiro[5.5]undecane |
| SMILES | COc1ccccc1N1CCC2(CCN(CCCSc3ncc(-c4ccccc4)n3C)CC2)CC1 |
| InChI | InChI=1S/C29H38N4OS/c1-31-26(24-9-4-3-5-10-24)23-30-28(31)35-22-8-17-32-18-13-29(14-19-32)15-20-33(21-16-29)25-11-6-7-12-27(25)34-2/h3-7,9-12,23H,8,13-22H2,1-2H3 |
| InChIKey | PQBWSEUMJSRWDF-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.72 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|