C19H28N4OS — CID 71294087
1-[3-[(4,5-dimethyl-1H-imidazol-2-yl)sulfanyl]propyl]-4-(2-methoxyphenyl)piperazine (PubChem CID 71294087) has the molecular formula C19H28N4OS and a molecular weight of 360.53 g/mol. Its IUPAC name is 1-[3-[(4,5-dimethyl-1H-imidazol-2-yl)sulfanyl]propyl]-4-(2-methoxyphenyl)piperazine.
| Compound Name | 1-[3-[(4,5-dimethyl-1H-imidazol-2-yl)sulfanyl]propyl]-4-(2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 71294087 |
| Molecular Formula | C19H28N4OS |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-[3-[(4,5-dimethyl-1H-imidazol-2-yl)sulfanyl]propyl]-4-(2-methoxyphenyl)piperazine |
| SMILES | COc1ccccc1N1CCN(CCCSc2nc(C)c(C)[nH]2)CC1 |
| InChI | InChI=1S/C19H28N4OS/c1-15-16(2)21-19(20-15)25-14-6-9-22-10-12-23(13-11-22)17-7-4-5-8-18(17)24-3/h4-5,7-8H,6,9-14H2,1-3H3,(H,20,21) |
| InChIKey | WUNBRKDVXXVJFW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|