C28H33N5O2S2 — CID 10626178
3-anilino-2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 10626178) has the molecular formula C28H33N5O2S2 and a molecular weight of 535.74 g/mol. Its IUPAC name is 3-anilino-2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-anilino-2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 10626178 |
| Molecular Formula | C28H33N5O2S2 |
| Molecular Weight | 535.74 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | 3-anilino-2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | COc1ccccc1N1CCN(CCCSc2nc3sc(C)c(C)c3c(=O)n2Nc2ccccc2)CC1 |
| InChI | InChI=1S/C28H33N5O2S2/c1-20-21(2)37-26-25(20)27(34)33(30-22-10-5-4-6-11-22)28(29-26)36-19-9-14-31-15-17-32(18-16-31)23-12-7-8-13-24(23)35-3/h4-8,10-13,30H,9,14-19H2,1-3H3 |
| InChIKey | OHTPJAXSYGJOBQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.74 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|