C29H22O8S — CID 10052723
[(6Z)-1-thiacyclodec-6-en-3,8-diyn-5-yl] (2R)-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracene-2-carboxylate (PubChem CID 10052723) has the molecular formula C29H22O8S and a molecular weight of 530.55 g/mol. Its IUPAC name is [(6Z)-1-thiacyclodec-6-en-3,8-diyn-5-yl] (2R)-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracene-2-carboxylate.
| Compound Name | [(6Z)-1-thiacyclodec-6-en-3,8-diyn-5-yl] (2R)-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracene-2-carboxylate |
|---|---|
| PubChem CID | 10052723 |
| Molecular Formula | C29H22O8S |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | [(6Z)-1-thiacyclodec-6-en-3,8-diyn-5-yl] (2R)-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracene-2-carboxylate |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(=O)OC1C#CCSCC#C/C=C\1)CC3 |
| InChI | InChI=1S/C29H22O8S/c1-36-20-10-5-9-18-21(20)27(33)23-22(25(18)31)26(32)19-15-29(35,12-11-17(19)24(23)30)28(34)37-16-7-3-2-4-13-38-14-6-8-16/h3,5,7,9-10,16,30,32,35H,11-15H2,1H3/b7-3-/t16?,29-/m1/s1 |
| InChIKey | LUSYQVABVQDWTG-ZLJRNJIOSA-N |
| XLogP | 2.32 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|