C27H38O2S — CID 57048892
O-(3,7-dimethylocta-2,6-dienyl) 2-(3,7-dimethylocta-2,6-dienoxy)benzenecarbothioate (PubChem CID 57048892) has the molecular formula C27H38O2S and a molecular weight of 426.67 g/mol. Its IUPAC name is O-(3,7-dimethylocta-2,6-dienyl) 2-(3,7-dimethylocta-2,6-dienoxy)benzenecarbothioate.
| Compound Name | O-(3,7-dimethylocta-2,6-dienyl) 2-(3,7-dimethylocta-2,6-dienoxy)benzenecarbothioate |
|---|---|
| PubChem CID | 57048892 |
| Molecular Formula | C27H38O2S |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | O-(3,7-dimethylocta-2,6-dienyl) 2-(3,7-dimethylocta-2,6-dienoxy)benzenecarbothioate |
| SMILES | CC(C)=CCCC(C)=CCOC(=S)c1ccccc1OCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C27H38O2S/c1-21(2)11-9-13-23(5)17-19-28-26-16-8-7-15-25(26)27(30)29-20-18-24(6)14-10-12-22(3)4/h7-8,11-12,15-18H,9-10,13-14,19-20H2,1-6H3 |
| InChIKey | BOQLWUIQCWFLCP-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|