C23H32N2O — CID 67055783
1-butyl-5-[2-(3,7-dimethylocta-2,6-dienoxy)phenyl]imidazole (PubChem CID 67055783) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is 1-butyl-5-[2-(3,7-dimethylocta-2,6-dienoxy)phenyl]imidazole.
| Compound Name | 1-butyl-5-[2-(3,7-dimethylocta-2,6-dienoxy)phenyl]imidazole |
|---|---|
| PubChem CID | 67055783 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 1-butyl-5-[2-(3,7-dimethylocta-2,6-dienoxy)phenyl]imidazole |
| SMILES | CCCCn1cncc1-c1ccccc1OCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C23H32N2O/c1-5-6-15-25-18-24-17-22(25)21-12-7-8-13-23(21)26-16-14-20(4)11-9-10-19(2)3/h7-8,10,12-14,17-18H,5-6,9,11,15-16H2,1-4H3 |
| InChIKey | QRHFNVTVLNXGKK-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|