C18H26N2OS — CID 71541050
1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(2-methoxyphenyl)thiourea (PubChem CID 71541050) has the molecular formula C18H26N2OS and a molecular weight of 318.49 g/mol. Its IUPAC name is 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 71541050 |
| Molecular Formula | C18H26N2OS |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)NC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C18H26N2OS/c1-14(2)8-7-9-15(3)12-13-19-18(22)20-16-10-5-6-11-17(16)21-4/h5-6,8,10-12H,7,9,13H2,1-4H3,(H2,19,20,22)/b15-12+ |
| InChIKey | DWKKPUUZLQWIJG-NTCAYCPXSA-N |
| XLogP | 4.67 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|