C15H26O12S2 — CID 159410023
methane;2-[2-[2-(2-methylsulfonyloxyprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylsulfonyloxyprop-2-enoate (PubChem CID 159410023) has the molecular formula C15H26O12S2 and a molecular weight of 462.50 g/mol. Its IUPAC name is methane;2-[2-[2-(2-methylsulfonyloxyprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylsulfonyloxyprop-2-enoate.
| Compound Name | methane;2-[2-[2-(2-methylsulfonyloxyprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylsulfonyloxyprop-2-enoate |
|---|---|
| PubChem CID | 159410023 |
| Molecular Formula | C15H26O12S2 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | methane;2-[2-[2-(2-methylsulfonyloxyprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylsulfonyloxyprop-2-enoate |
| SMILES | C.C=C(OS(C)(=O)=O)C(=O)OCCOCCOCCOC(=O)C(=C)OS(C)(=O)=O |
| InChI | InChI=1S/C14H22O12S2.CH4/c1-11(25-27(3,17)18)13(15)23-9-7-21-5-6-22-8-10-24-14(16)12(2)26-28(4,19)20;/h1-2,5-10H2,3-4H3;1H4 |
| InChIKey | LOLRUTUIDOLZLD-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|