C27H43ClO22S3 — CID 158987317
methanesulfonyl chloride;methylsulfonyl 2-[2-[2-[2-(2-methylsulfonyloxyprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]prop-2-enoate;2-[2-[2-(2-oxopropanoyloxy)ethoxy]ethoxy]ethyl 2-oxopropanoate (PubChem CID 158987317) has the molecular formula C27H43ClO22S3 and a molecular weight of 851.27 g/mol. Its IUPAC name is methanesulfonyl chloride;methylsulfonyl 2-[2-[2-[2-(2-methylsulfonyloxyprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]prop-2-enoate;2-[2-[2-(2-oxopropanoyloxy)ethoxy]ethoxy]ethyl 2-oxopropanoate.
| Compound Name | methanesulfonyl chloride;methylsulfonyl 2-[2-[2-[2-(2-methylsulfonyloxyprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]prop-2-enoate;2-[2-[2-(2-oxopropanoyloxy)ethoxy]ethoxy]ethyl 2-oxopropanoate |
|---|---|
| PubChem CID | 158987317 |
| Molecular Formula | C27H43ClO22S3 |
| Molecular Weight | 851.27 g/mol |
| Exact Mass | 850.11 |
| IUPAC Name | methanesulfonyl chloride;methylsulfonyl 2-[2-[2-[2-(2-methylsulfonyloxyprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]prop-2-enoate;2-[2-[2-(2-oxopropanoyloxy)ethoxy]ethoxy]ethyl 2-oxopropanoate |
| SMILES | C=C(OS(C)(=O)=O)C(=O)OCCOCCOCCOC(=C)C(=O)OS(C)(=O)=O.CC(=O)C(=O)OCCOCCOCCOC(=O)C(C)=O.CS(=O)(=O)Cl |
| InChI | InChI=1S/C14H22O12S2.C12H18O8.CH3ClO2S/c1-11(14(16)26-28(4,19)20)23-9-7-21-5-6-22-8-10-24-13(15)12(2)25-27(3,17)18;1-9(13)11(15)19-7-5-17-3-4-18-6-8-20-12(16)10(2)14;1-5(2,3)4/h1-2,5-10H2,3-4H3;3-8H2,1-2H3;1H3 |
| InChIKey | JPSOFLRDKJCPOP-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 297.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.27 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|