C16H28N2O6 — CID 88880716
[2,2,4-trimethyl-5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]pentyl]carbamic acid (PubChem CID 88880716) has the molecular formula C16H28N2O6 and a molecular weight of 344.41 g/mol. Its IUPAC name is [2,2,4-trimethyl-5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]pentyl]carbamic acid.
| Compound Name | [2,2,4-trimethyl-5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]pentyl]carbamic acid |
|---|---|
| PubChem CID | 88880716 |
| Molecular Formula | C16H28N2O6 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | [2,2,4-trimethyl-5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]pentyl]carbamic acid |
| SMILES | C=C(C)C(=O)OCCOC(=O)NCC(C)CC(C)(C)CNC(=O)O |
| InChI | InChI=1S/C16H28N2O6/c1-11(2)13(19)23-6-7-24-15(22)17-9-12(3)8-16(4,5)10-18-14(20)21/h12,18H,1,6-10H2,2-5H3,(H,17,22)(H,20,21) |
| InChIKey | KHPMUGORTLLNGY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|