C26H45NO8 — CID 159097425
2-(2-methylprop-2-enoyloxy)ethyl butanoate;2-(2,4,4-trimethylhexylcarbamoyloxy)ethyl 2-methylprop-2-enoate (PubChem CID 159097425) has the molecular formula C26H45NO8 and a molecular weight of 499.65 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl butanoate;2-(2,4,4-trimethylhexylcarbamoyloxy)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl butanoate;2-(2,4,4-trimethylhexylcarbamoyloxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159097425 |
| Molecular Formula | C26H45NO8 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl butanoate;2-(2,4,4-trimethylhexylcarbamoyloxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCC.C=C(C)C(=O)OCCOC(=O)NCC(C)CC(C)(C)CC |
| InChI | InChI=1S/C16H29NO4.C10H16O4/c1-7-16(5,6)10-13(4)11-17-15(19)21-9-8-20-14(18)12(2)3;1-4-5-9(11)13-6-7-14-10(12)8(2)3/h13H,2,7-11H2,1,3-6H3,(H,17,19);2,4-7H2,1,3H3 |
| InChIKey | KCVPABJERLJJFL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|