C24H40N2O8 — CID 23575455
2-[[3,3,5,5-tetramethyl-6-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]hexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 23575455) has the molecular formula C24H40N2O8 and a molecular weight of 484.59 g/mol. Its IUPAC name is 2-[[3,3,5,5-tetramethyl-6-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]hexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[3,3,5,5-tetramethyl-6-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]hexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23575455 |
| Molecular Formula | C24H40N2O8 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 2-[[3,3,5,5-tetramethyl-6-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]hexyl]carbamoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)NCCC(C)(C)CC(C)(C)CNC(=O)OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C24H40N2O8/c1-17(2)19(27)31-11-13-33-21(29)25-10-9-23(5,6)15-24(7,8)16-26-22(30)34-14-12-32-20(28)18(3)4/h1,3,9-16H2,2,4-8H3,(H,25,29)(H,26,30) |
| InChIKey | QIMYLOLTSGIKNZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|