C12H9F8NO2 — CID 3099801
N-(2,2,3,3,4,4,5,5-octafluoro-1-hydroxypentyl)benzamide (PubChem CID 3099801) has the molecular formula C12H9F8NO2 and a molecular weight of 351.19 g/mol. Its IUPAC name is N-(2,2,3,3,4,4,5,5-octafluoro-1-hydroxypentyl)benzamide.
| Compound Name | N-(2,2,3,3,4,4,5,5-octafluoro-1-hydroxypentyl)benzamide |
|---|---|
| PubChem CID | 3099801 |
| Molecular Formula | C12H9F8NO2 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | N-(2,2,3,3,4,4,5,5-octafluoro-1-hydroxypentyl)benzamide |
| SMILES | O=C(NC(O)C(F)(F)C(F)(F)C(F)(F)C(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H9F8NO2/c13-8(14)10(15,16)12(19,20)11(17,18)9(23)21-7(22)6-4-2-1-3-5-6/h1-5,8-9,23H,(H,21,22) |
| InChIKey | CYRKHKSTQZXEFE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|