C14H10F8N4O3 — CID 98231114
methyl 2-[[(1R)-1-(benzotriazol-1-yl)-2,2,3,3,4,4,5,5-octafluoropentyl]amino]-2-oxoacetate (PubChem CID 98231114) has the molecular formula C14H10F8N4O3 and a molecular weight of 434.24 g/mol. Its IUPAC name is methyl 2-[[(1R)-1-(benzotriazol-1-yl)-2,2,3,3,4,4,5,5-octafluoropentyl]amino]-2-oxoacetate.
| Compound Name | methyl 2-[[(1R)-1-(benzotriazol-1-yl)-2,2,3,3,4,4,5,5-octafluoropentyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 98231114 |
| Molecular Formula | C14H10F8N4O3 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | methyl 2-[[(1R)-1-(benzotriazol-1-yl)-2,2,3,3,4,4,5,5-octafluoropentyl]amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)N[C@H](n1nnc2ccccc21)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H10F8N4O3/c1-29-9(28)8(27)23-11(26-7-5-3-2-4-6(7)24-25-26)13(19,20)14(21,22)12(17,18)10(15)16/h2-5,10-11H,1H3,(H,23,27)/t11-/m1/s1 |
| InChIKey | MQWIHJGWZLDZND-LLVKDONJSA-N |
| XLogP | 2.39 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|