C30H26N8O4 — CID 10530945
N-[1,2-bis(benzotriazol-1-yl)-2-[(4-methoxybenzoyl)amino]ethyl]-4-methoxybenzamide (PubChem CID 10530945) has the molecular formula C30H26N8O4 and a molecular weight of 562.59 g/mol. Its IUPAC name is N-[1,2-bis(benzotriazol-1-yl)-2-[(4-methoxybenzoyl)amino]ethyl]-4-methoxybenzamide.
| Compound Name | N-[1,2-bis(benzotriazol-1-yl)-2-[(4-methoxybenzoyl)amino]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 10530945 |
| Molecular Formula | C30H26N8O4 |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | N-[1,2-bis(benzotriazol-1-yl)-2-[(4-methoxybenzoyl)amino]ethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(C(NC(=O)c2ccc(OC)cc2)n2nnc3ccccc32)n2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C30H26N8O4/c1-41-21-15-11-19(12-16-21)29(39)31-27(37-25-9-5-3-7-23(25)33-35-37)28(38-26-10-6-4-8-24(26)34-36-38)32-30(40)20-13-17-22(42-2)18-14-20/h3-18,27-28H,1-2H3,(H,31,39)(H,32,40) |
| InChIKey | XHIYXXLIBJWMPR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |