About [benzotriazol-1-yl(phenyl)methyl] 4-methoxybenzoate
[benzotriazol-1-yl(phenyl)methyl] 4-methoxybenzoate (PubChem CID 3743823) has the molecular formula C21H17N3O3
and a molecular weight of 359.39 g/mol. Its IUPAC name is [benzotriazol-1-yl(phenyl)methyl] 4-methoxybenzoate.
Molecular Properties
| Compound Name | [benzotriazol-1-yl(phenyl)methyl] 4-methoxybenzoate |
| PubChem CID | 3743823 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | [benzotriazol-1-yl(phenyl)methyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC(c2ccccc2)n2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C21H17N3O3/c1-26-17-13-11-16(12-14-17)21(25)27-20(15-7-3-2-4-8-15)24-19-10-6-5-9-18(19)22-23-24/h2-14,20H,1H3 |
| InChIKey | FIVRHFKAZNDZPO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [benzotriazol-1-yl(phenyl)methyl] 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [benzotriazol-1-yl(phenyl)methyl] 4-methoxybenzoate?
The IUPAC name of [benzotriazol-1-yl(phenyl)methyl] 4-methoxybenzoate (CID 3743823) is [benzotriazol-1-yl(phenyl)methyl] 4-methoxybenzoate.
What is the SMILES notation for [benzotriazol-1-yl(phenyl)methyl] 4-methoxybenzoate?
The canonical SMILES for [benzotriazol-1-yl(phenyl)methyl] 4-methoxybenzoate is COc1ccc(C(=O)OC(c2ccccc2)n2nnc3ccccc32)cc1.
What is the InChIKey of [benzotriazol-1-yl(phenyl)methyl] 4-methoxybenzoate?
The InChIKey is FIVRHFKAZNDZPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O3/c1-26-17-13-11-16(12-14-17)21(25)27-20(15-7-3-2-4-8-15)24-19-10-6-5-9-18(19)22-23-24/h2-14,20H,1H3.
What are the key properties of [benzotriazol-1-yl(phenyl)methyl] 4-methoxybenzoate?
[benzotriazol-1-yl(phenyl)methyl] 4-methoxybenzoate has a molecular weight of 359.39 g/mol, XLogP of 3.84, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [benzotriazol-1-yl(phenyl)methyl] 4-methoxybenzoate is sourced from PubChem (CID 3743823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).