C22H15N5O3S — CID 22713240
benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate (PubChem CID 22713240) has the molecular formula C22H15N5O3S and a molecular weight of 429.46 g/mol. Its IUPAC name is benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate.
| Compound Name | benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 22713240 |
| Molecular Formula | C22H15N5O3S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate |
| SMILES | COc1ccc(-c2nnc(-c3ccc(C(=O)On4nnc5ccccc54)cc3)s2)cc1 |
| InChI | InChI=1S/C22H15N5O3S/c1-29-17-12-10-15(11-13-17)21-25-24-20(31-21)14-6-8-16(9-7-14)22(28)30-27-19-5-3-2-4-18(19)23-26-27/h2-13H,1H3 |
| InChIKey | WEOFYMRDJQRTCT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|