About benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate
benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate (PubChem CID 22713240) has the molecular formula C22H15N5O3S
and a molecular weight of 429.46 g/mol. Its IUPAC name is benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate.
Molecular Properties
| Compound Name | benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate |
| PubChem CID | 22713240 |
| Molecular Formula | C22H15N5O3S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate |
| SMILES | COc1ccc(-c2nnc(-c3ccc(C(=O)On4nnc5ccccc54)cc3)s2)cc1 |
| InChI | InChI=1S/C22H15N5O3S/c1-29-17-12-10-15(11-13-17)21-25-24-20(31-21)14-6-8-16(9-7-14)22(28)30-27-19-5-3-2-4-18(19)23-26-27/h2-13H,1H3 |
| InChIKey | WEOFYMRDJQRTCT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|
Analyze benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate?
The IUPAC name of benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate (CID 22713240) is benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate.
What is the SMILES notation for benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate?
The canonical SMILES for benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate is COc1ccc(-c2nnc(-c3ccc(C(=O)On4nnc5ccccc54)cc3)s2)cc1.
What is the InChIKey of benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate?
The InChIKey is WEOFYMRDJQRTCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15N5O3S/c1-29-17-12-10-15(11-13-17)21-25-24-20(31-21)14-6-8-16(9-7-14)22(28)30-27-19-5-3-2-4-18(19)23-26-27/h2-13H,1H3.
What are the key properties of benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate?
benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate has a molecular weight of 429.46 g/mol, XLogP of 3.89, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for benzotriazol-1-yl 4-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate is sourced from PubChem (CID 22713240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).