C30H22N2O6S — CID 54396974
(3-methoxyphenyl) 4-[5-[4-(3-methoxyphenoxy)carbonylphenyl]-1,3,4-thiadiazol-2-yl]benzoate (PubChem CID 54396974) has the molecular formula C30H22N2O6S and a molecular weight of 538.58 g/mol. Its IUPAC name is (3-methoxyphenyl) 4-[5-[4-(3-methoxyphenoxy)carbonylphenyl]-1,3,4-thiadiazol-2-yl]benzoate.
| Compound Name | (3-methoxyphenyl) 4-[5-[4-(3-methoxyphenoxy)carbonylphenyl]-1,3,4-thiadiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 54396974 |
| Molecular Formula | C30H22N2O6S |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | (3-methoxyphenyl) 4-[5-[4-(3-methoxyphenoxy)carbonylphenyl]-1,3,4-thiadiazol-2-yl]benzoate |
| SMILES | COc1cccc(OC(=O)c2ccc(-c3nnc(-c4ccc(C(=O)Oc5cccc(OC)c5)cc4)s3)cc2)c1 |
| InChI | InChI=1S/C30H22N2O6S/c1-35-23-5-3-7-25(17-23)37-29(33)21-13-9-19(10-14-21)27-31-32-28(39-27)20-11-15-22(16-12-20)30(34)38-26-8-4-6-24(18-26)36-2/h3-18H,1-2H3 |
| InChIKey | VKRJKVUUCBRJPJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|