C28H33N5O4S — CID 20655269
benzotriazol-1-yl 4-[5-[4-(6-methoxyhexoxy)phenyl]-1,3,4-thiadiazol-2-yl]cyclohexane-1-carboxylate (PubChem CID 20655269) has the molecular formula C28H33N5O4S and a molecular weight of 535.67 g/mol. Its IUPAC name is benzotriazol-1-yl 4-[5-[4-(6-methoxyhexoxy)phenyl]-1,3,4-thiadiazol-2-yl]cyclohexane-1-carboxylate.
| Compound Name | benzotriazol-1-yl 4-[5-[4-(6-methoxyhexoxy)phenyl]-1,3,4-thiadiazol-2-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 20655269 |
| Molecular Formula | C28H33N5O4S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | benzotriazol-1-yl 4-[5-[4-(6-methoxyhexoxy)phenyl]-1,3,4-thiadiazol-2-yl]cyclohexane-1-carboxylate |
| SMILES | COCCCCCCOc1ccc(-c2nnc(C3CCC(C(=O)On4nnc5ccccc54)CC3)s2)cc1 |
| InChI | InChI=1S/C28H33N5O4S/c1-35-18-6-2-3-7-19-36-23-16-14-21(15-17-23)27-31-30-26(38-27)20-10-12-22(13-11-20)28(34)37-33-25-9-5-4-8-24(25)29-32-33/h4-5,8-9,14-17,20,22H,2-3,6-7,10-13,18-19H2,1H3 |
| InChIKey | MMXOLFWKPAZQSA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 101.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|