C24H31N3O3S — CID 90702154
4-[2-[4-(6-methoxyhexoxy)phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]cyclohexane-1-carbaldehyde (PubChem CID 90702154) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is 4-[2-[4-(6-methoxyhexoxy)phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[2-[4-(6-methoxyhexoxy)phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 90702154 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 4-[2-[4-(6-methoxyhexoxy)phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]cyclohexane-1-carbaldehyde |
| SMILES | COCCCCCCOc1ccc(-c2nn3cc(C4CCC(C=O)CC4)nc3s2)cc1 |
| InChI | InChI=1S/C24H31N3O3S/c1-29-14-4-2-3-5-15-30-21-12-10-20(11-13-21)23-26-27-16-22(25-24(27)31-23)19-8-6-18(17-28)7-9-19/h10-13,16-19H,2-9,14-15H2,1H3 |
| InChIKey | VQSXGLDJAJAMNM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|