C26H28N2O4S — CID 20655231
[6-[5-[4-(6-methoxyhexoxy)phenyl]-1,3,4-thiadiazol-2-yl]naphthalen-2-yl]methanediol (PubChem CID 20655231) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is [6-[5-[4-(6-methoxyhexoxy)phenyl]-1,3,4-thiadiazol-2-yl]naphthalen-2-yl]methanediol.
| Compound Name | [6-[5-[4-(6-methoxyhexoxy)phenyl]-1,3,4-thiadiazol-2-yl]naphthalen-2-yl]methanediol |
|---|---|
| PubChem CID | 20655231 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | [6-[5-[4-(6-methoxyhexoxy)phenyl]-1,3,4-thiadiazol-2-yl]naphthalen-2-yl]methanediol |
| SMILES | COCCCCCCOc1ccc(-c2nnc(-c3ccc4cc(C(O)O)ccc4c3)s2)cc1 |
| InChI | InChI=1S/C26H28N2O4S/c1-31-14-4-2-3-5-15-32-23-12-10-18(11-13-23)24-27-28-25(33-24)21-8-6-20-17-22(26(29)30)9-7-19(20)16-21/h6-13,16-17,26,29-30H,2-5,14-15H2,1H3 |
| InChIKey | LVXGQVIWIGFLEN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|