C24H24N2O3S — CID 136901999
4-[5-(6-hexoxynaphthalen-2-yl)-1,3,4-thiadiazol-2-yl]benzene-1,3-diol (PubChem CID 136901999) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is 4-[5-(6-hexoxynaphthalen-2-yl)-1,3,4-thiadiazol-2-yl]benzene-1,3-diol.
| Compound Name | 4-[5-(6-hexoxynaphthalen-2-yl)-1,3,4-thiadiazol-2-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136901999 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 4-[5-(6-hexoxynaphthalen-2-yl)-1,3,4-thiadiazol-2-yl]benzene-1,3-diol |
| SMILES | CCCCCCOc1ccc2cc(-c3nnc(-c4ccc(O)cc4O)s3)ccc2c1 |
| InChI | InChI=1S/C24H24N2O3S/c1-2-3-4-5-12-29-20-10-8-16-13-18(7-6-17(16)14-20)23-25-26-24(30-23)21-11-9-19(27)15-22(21)28/h6-11,13-15,27-28H,2-5,12H2,1H3 |
| InChIKey | XJBCGWHUVMMFSZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|