C24H27FN2O3S — CID 135264547
3-[3-fluoro-4-[5-(4-heptoxyphenyl)-1,3,4-thiadiazol-2-yl]phenyl]propanoic acid (PubChem CID 135264547) has the molecular formula C24H27FN2O3S and a molecular weight of 442.56 g/mol. Its IUPAC name is 3-[3-fluoro-4-[5-(4-heptoxyphenyl)-1,3,4-thiadiazol-2-yl]phenyl]propanoic acid.
| Compound Name | 3-[3-fluoro-4-[5-(4-heptoxyphenyl)-1,3,4-thiadiazol-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 135264547 |
| Molecular Formula | C24H27FN2O3S |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 3-[3-fluoro-4-[5-(4-heptoxyphenyl)-1,3,4-thiadiazol-2-yl]phenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2nnc(-c3ccc(CCC(=O)O)cc3F)s2)cc1 |
| InChI | InChI=1S/C24H27FN2O3S/c1-2-3-4-5-6-15-30-19-11-9-18(10-12-19)23-26-27-24(31-23)20-13-7-17(16-21(20)25)8-14-22(28)29/h7,9-13,16H,2-6,8,14-15H2,1H3,(H,28,29) |
| InChIKey | QSCQOTJAFCOMNQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|