C22H25BrN2OS — CID 145099219
2-(4-bromo-2-methylphenyl)-5-(4-heptoxyphenyl)-1,3,4-thiadiazole (PubChem CID 145099219) has the molecular formula C22H25BrN2OS and a molecular weight of 445.43 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)-5-(4-heptoxyphenyl)-1,3,4-thiadiazole.
| Compound Name | 2-(4-bromo-2-methylphenyl)-5-(4-heptoxyphenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 145099219 |
| Molecular Formula | C22H25BrN2OS |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)-5-(4-heptoxyphenyl)-1,3,4-thiadiazole |
| SMILES | CCCCCCCOc1ccc(-c2nnc(-c3ccc(Br)cc3C)s2)cc1 |
| InChI | InChI=1S/C22H25BrN2OS/c1-3-4-5-6-7-14-26-19-11-8-17(9-12-19)21-24-25-22(27-21)20-13-10-18(23)15-16(20)2/h8-13,15H,3-7,14H2,1-2H3 |
| InChIKey | OIJXMMBCQZNETH-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|