C35H48N2O3S — CID 57141578
2-[4-[(1S)-1-octoxycyclopent-2-en-1-yl]oxyphenyl]-5-(4-octoxyphenyl)-1,3,4-thiadiazole (PubChem CID 57141578) has the molecular formula C35H48N2O3S and a molecular weight of 576.85 g/mol. Its IUPAC name is 2-[4-[(1S)-1-octoxycyclopent-2-en-1-yl]oxyphenyl]-5-(4-octoxyphenyl)-1,3,4-thiadiazole.
| Compound Name | 2-[4-[(1S)-1-octoxycyclopent-2-en-1-yl]oxyphenyl]-5-(4-octoxyphenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 57141578 |
| Molecular Formula | C35H48N2O3S |
| Molecular Weight | 576.85 g/mol |
| Exact Mass | 576.34 |
| IUPAC Name | 2-[4-[(1S)-1-octoxycyclopent-2-en-1-yl]oxyphenyl]-5-(4-octoxyphenyl)-1,3,4-thiadiazole |
| SMILES | CCCCCCCCOc1ccc(-c2nnc(-c3ccc(O[C@]4(OCCCCCCCC)C=CCC4)cc3)s2)cc1 |
| InChI | InChI=1S/C35H48N2O3S/c1-3-5-7-9-11-15-27-38-31-21-17-29(18-22-31)33-36-37-34(41-33)30-19-23-32(24-20-30)40-35(25-13-14-26-35)39-28-16-12-10-8-6-4-2/h13,17-25H,3-12,14-16,26-28H2,1-2H3/t35-/m1/s1 |
| InChIKey | MGZUILYTKSICCH-PGUFJCEWSA-N |
| XLogP | 10.41 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.85 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|