C31H40N2O3S — CID 19431188
2-[4-(1-butoxycyclopent-2-en-1-yl)oxyphenyl]-5-(4-octoxyphenyl)-1,3,4-thiadiazole (PubChem CID 19431188) has the molecular formula C31H40N2O3S and a molecular weight of 520.74 g/mol. Its IUPAC name is 2-[4-(1-butoxycyclopent-2-en-1-yl)oxyphenyl]-5-(4-octoxyphenyl)-1,3,4-thiadiazole.
| Compound Name | 2-[4-(1-butoxycyclopent-2-en-1-yl)oxyphenyl]-5-(4-octoxyphenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 19431188 |
| Molecular Formula | C31H40N2O3S |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | 2-[4-(1-butoxycyclopent-2-en-1-yl)oxyphenyl]-5-(4-octoxyphenyl)-1,3,4-thiadiazole |
| SMILES | CCCCCCCCOc1ccc(-c2nnc(-c3ccc(OC4(OCCCC)C=CCC4)cc3)s2)cc1 |
| InChI | InChI=1S/C31H40N2O3S/c1-3-5-7-8-9-12-23-34-27-17-13-25(14-18-27)29-32-33-30(37-29)26-15-19-28(20-16-26)36-31(21-10-11-22-31)35-24-6-4-2/h10,13-21H,3-9,11-12,22-24H2,1-2H3 |
| InChIKey | JWLQVNYGNVYSGX-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|