C26H26N2O4S — CID 20655135
2-[4-[4-(3-methoxypropoxy)phenyl]phenyl]-5-[4-(methylperoxymethyl)phenyl]-1,3,4-thiadiazole (PubChem CID 20655135) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is 2-[4-[4-(3-methoxypropoxy)phenyl]phenyl]-5-[4-(methylperoxymethyl)phenyl]-1,3,4-thiadiazole.
| Compound Name | 2-[4-[4-(3-methoxypropoxy)phenyl]phenyl]-5-[4-(methylperoxymethyl)phenyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 20655135 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-[4-[4-(3-methoxypropoxy)phenyl]phenyl]-5-[4-(methylperoxymethyl)phenyl]-1,3,4-thiadiazole |
| SMILES | COCCCOc1ccc(-c2ccc(-c3nnc(-c4ccc(COOC)cc4)s3)cc2)cc1 |
| InChI | InChI=1S/C26H26N2O4S/c1-29-16-3-17-31-24-14-12-21(13-15-24)20-8-10-23(11-9-20)26-28-27-25(33-26)22-6-4-19(5-7-22)18-32-30-2/h4-15H,3,16-18H2,1-2H3 |
| InChIKey | QELNVPJRIWJFFG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|