C23H23N3O2S — CID 20729346
1-[4-[2-(4-pentoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]phenyl]ethanone (PubChem CID 20729346) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-[4-[2-(4-pentoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]phenyl]ethanone.
| Compound Name | 1-[4-[2-(4-pentoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 20729346 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-[4-[2-(4-pentoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]phenyl]ethanone |
| SMILES | CCCCCOc1ccc(-c2nn3cc(-c4ccc(C(C)=O)cc4)nc3s2)cc1 |
| InChI | InChI=1S/C23H23N3O2S/c1-3-4-5-14-28-20-12-10-19(11-13-20)22-25-26-15-21(24-23(26)29-22)18-8-6-17(7-9-18)16(2)27/h6-13,15H,3-5,14H2,1-2H3 |
| InChIKey | UPIUAAPBXLFECZ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|