C28H24N6O4S — CID 154075627
benzotriazol-1-yl 2-[2-[4-(4-methoxybutoxy)phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]benzoate (PubChem CID 154075627) has the molecular formula C28H24N6O4S and a molecular weight of 540.61 g/mol. Its IUPAC name is benzotriazol-1-yl 2-[2-[4-(4-methoxybutoxy)phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]benzoate.
| Compound Name | benzotriazol-1-yl 2-[2-[4-(4-methoxybutoxy)phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]benzoate |
|---|---|
| PubChem CID | 154075627 |
| Molecular Formula | C28H24N6O4S |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | benzotriazol-1-yl 2-[2-[4-(4-methoxybutoxy)phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]benzoate |
| SMILES | COCCCCOc1ccc(-c2nn3cc(-c4ccccc4C(=O)On4nnc5ccccc54)nc3s2)cc1 |
| InChI | InChI=1S/C28H24N6O4S/c1-36-16-6-7-17-37-20-14-12-19(13-15-20)26-31-33-18-24(29-28(33)39-26)21-8-2-3-9-22(21)27(35)38-34-25-11-5-4-10-23(25)30-32-34/h2-5,8-15,18H,6-7,16-17H2,1H3 |
| InChIKey | SHTIDSHJYFLXJH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|