C15H15N3O4S — CID 154810945
2-methoxyethyl 6-(4-methoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazole-2-carboxylate (PubChem CID 154810945) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is 2-methoxyethyl 6-(4-methoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazole-2-carboxylate.
| Compound Name | 2-methoxyethyl 6-(4-methoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 154810945 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-methoxyethyl 6-(4-methoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazole-2-carboxylate |
| SMILES | COCCOC(=O)c1nn2cc(-c3ccc(OC)cc3)nc2s1 |
| InChI | InChI=1S/C15H15N3O4S/c1-20-7-8-22-14(19)13-17-18-9-12(16-15(18)23-13)10-3-5-11(21-2)6-4-10/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | RHJDIWZJQJBMTI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|