C26H29N5O2S — CID 18690345
(3-oxidobenzotriazol-3-ium-1-yl)-[4-[5-(4-pentylcyclohexyl)-1,3,4-thiadiazol-2-yl]phenyl]methanone (PubChem CID 18690345) has the molecular formula C26H29N5O2S and a molecular weight of 475.62 g/mol. Its IUPAC name is (3-oxidobenzotriazol-3-ium-1-yl)-[4-[5-(4-pentylcyclohexyl)-1,3,4-thiadiazol-2-yl]phenyl]methanone.
| Compound Name | (3-oxidobenzotriazol-3-ium-1-yl)-[4-[5-(4-pentylcyclohexyl)-1,3,4-thiadiazol-2-yl]phenyl]methanone |
|---|---|
| PubChem CID | 18690345 |
| Molecular Formula | C26H29N5O2S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | (3-oxidobenzotriazol-3-ium-1-yl)-[4-[5-(4-pentylcyclohexyl)-1,3,4-thiadiazol-2-yl]phenyl]methanone |
| SMILES | CCCCCC1CCC(c2nnc(-c3ccc(C(=O)n4n[n+]([O-])c5ccccc54)cc3)s2)CC1 |
| InChI | InChI=1S/C26H29N5O2S/c1-2-3-4-7-18-10-12-19(13-11-18)24-27-28-25(34-24)20-14-16-21(17-15-20)26(32)30-22-8-5-6-9-23(22)31(33)29-30/h5-6,8-9,14-19H,2-4,7,10-13H2,1H3 |
| InChIKey | XGVRKYADNGVFCL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|