C27H41BrN2OS — CID 15597073
2-(3-bromo-4-nonoxyphenyl)-5-(4-butylcyclohexyl)-1,3,4-thiadiazole (PubChem CID 15597073) has the molecular formula C27H41BrN2OS and a molecular weight of 521.61 g/mol. Its IUPAC name is 2-(3-bromo-4-nonoxyphenyl)-5-(4-butylcyclohexyl)-1,3,4-thiadiazole.
| Compound Name | 2-(3-bromo-4-nonoxyphenyl)-5-(4-butylcyclohexyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 15597073 |
| Molecular Formula | C27H41BrN2OS |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 2-(3-bromo-4-nonoxyphenyl)-5-(4-butylcyclohexyl)-1,3,4-thiadiazole |
| SMILES | CCCCCCCCCOc1ccc(-c2nnc(C3CCC(CCCC)CC3)s2)cc1Br |
| InChI | InChI=1S/C27H41BrN2OS/c1-3-5-7-8-9-10-11-19-31-25-18-17-23(20-24(25)28)27-30-29-26(32-27)22-15-13-21(14-16-22)12-6-4-2/h17-18,20-22H,3-16,19H2,1-2H3 |
| InChIKey | WNCUHHQSGMACFL-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|